C9H7N3OS — CID 130016702
5-phenyl-1,2,4-oxadiazole-3-carbothioamide (PubChem CID 130016702) has the molecular formula C9H7N3OS and a molecular weight of 205.24 g/mol. Its IUPAC name is 5-phenyl-1,2,4-oxadiazole-3-carbothioamide.
| Compound Name | 5-phenyl-1,2,4-oxadiazole-3-carbothioamide |
|---|---|
| PubChem CID | 130016702 |
| Molecular Formula | C9H7N3OS |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 5-phenyl-1,2,4-oxadiazole-3-carbothioamide |
| SMILES | NC(=S)c1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H7N3OS/c10-7(14)8-11-9(13-12-8)6-4-2-1-3-5-6/h1-5H,(H2,10,14) |
| InChIKey | VJQNOXGUZXSSAC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|