C10H9N3S2 — CID 125494165
5-amino-2-phenyl-1,3-thiazole-4-carbothioamide (PubChem CID 125494165) has the molecular formula C10H9N3S2 and a molecular weight of 235.34 g/mol. Its IUPAC name is 5-amino-2-phenyl-1,3-thiazole-4-carbothioamide.
| Compound Name | 5-amino-2-phenyl-1,3-thiazole-4-carbothioamide |
|---|---|
| PubChem CID | 125494165 |
| Molecular Formula | C10H9N3S2 |
| Molecular Weight | 235.34 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 5-amino-2-phenyl-1,3-thiazole-4-carbothioamide |
| SMILES | NC(=S)c1nc(-c2ccccc2)sc1N |
| InChI | InChI=1S/C10H9N3S2/c11-8(14)7-9(12)15-10(13-7)6-4-2-1-3-5-6/h1-5H,12H2,(H2,11,14) |
| InChIKey | FQWQECGMFSAFJQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|