About 4-butyl-2-phenyl-1,3-thiazol-5-amine
4-butyl-2-phenyl-1,3-thiazol-5-amine (PubChem CID 62077156) has the molecular formula C13H16N2S
and a molecular weight of 232.35 g/mol. Its IUPAC name is 4-butyl-2-phenyl-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | 4-butyl-2-phenyl-1,3-thiazol-5-amine |
| PubChem CID | 62077156 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 4-butyl-2-phenyl-1,3-thiazol-5-amine |
| SMILES | CCCCc1nc(-c2ccccc2)sc1N |
| InChI | InChI=1S/C13H16N2S/c1-2-3-9-11-12(14)16-13(15-11)10-7-5-4-6-8-10/h4-8H,2-3,9,14H2,1H3 |
| InChIKey | BTZRKFXLRTWLGQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-butyl-2-phenyl-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-2-phenyl-1,3-thiazol-5-amine?
The IUPAC name of 4-butyl-2-phenyl-1,3-thiazol-5-amine (CID 62077156) is 4-butyl-2-phenyl-1,3-thiazol-5-amine.
What is the SMILES notation for 4-butyl-2-phenyl-1,3-thiazol-5-amine?
The canonical SMILES for 4-butyl-2-phenyl-1,3-thiazol-5-amine is CCCCc1nc(-c2ccccc2)sc1N.
What is the InChIKey of 4-butyl-2-phenyl-1,3-thiazol-5-amine?
The InChIKey is BTZRKFXLRTWLGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2S/c1-2-3-9-11-12(14)16-13(15-11)10-7-5-4-6-8-10/h4-8H,2-3,9,14H2,1H3.
What are the key properties of 4-butyl-2-phenyl-1,3-thiazol-5-amine?
4-butyl-2-phenyl-1,3-thiazol-5-amine has a molecular weight of 232.35 g/mol, XLogP of 3.73, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-2-phenyl-1,3-thiazol-5-amine is sourced from PubChem (CID 62077156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).