C20H20ClNS — CID 46862434
4-benzyl-5-butyl-2-(4-chlorophenyl)-1,3-thiazole (PubChem CID 46862434) has the molecular formula C20H20ClNS and a molecular weight of 341.91 g/mol. Its IUPAC name is 4-benzyl-5-butyl-2-(4-chlorophenyl)-1,3-thiazole.
| Compound Name | 4-benzyl-5-butyl-2-(4-chlorophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 46862434 |
| Molecular Formula | C20H20ClNS |
| Molecular Weight | 341.91 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 4-benzyl-5-butyl-2-(4-chlorophenyl)-1,3-thiazole |
| SMILES | CCCCc1sc(-c2ccc(Cl)cc2)nc1Cc1ccccc1 |
| InChI | InChI=1S/C20H20ClNS/c1-2-3-9-19-18(14-15-7-5-4-6-8-15)22-20(23-19)16-10-12-17(21)13-11-16/h4-8,10-13H,2-3,9,14H2,1H3 |
| InChIKey | UUVUVOFEXFQCPR-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.91 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |