C30H22N2S2 — CID 166805666
2,5-bis(4-benzylphenyl)-[1,3]thiazolo[5,4-d][1,3]thiazole (PubChem CID 166805666) has the molecular formula C30H22N2S2 and a molecular weight of 474.65 g/mol. Its IUPAC name is 2,5-bis(4-benzylphenyl)-[1,3]thiazolo[5,4-d][1,3]thiazole.
| Compound Name | 2,5-bis(4-benzylphenyl)-[1,3]thiazolo[5,4-d][1,3]thiazole |
|---|---|
| PubChem CID | 166805666 |
| Molecular Formula | C30H22N2S2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 2,5-bis(4-benzylphenyl)-[1,3]thiazolo[5,4-d][1,3]thiazole |
| SMILES | c1ccc(Cc2ccc(-c3nc4sc(-c5ccc(Cc6ccccc6)cc5)nc4s3)cc2)cc1 |
| InChI | InChI=1S/C30H22N2S2/c1-3-7-21(8-4-1)19-23-11-15-25(16-12-23)27-31-29-30(33-27)32-28(34-29)26-17-13-24(14-18-26)20-22-9-5-2-6-10-22/h1-18H,19-20H2 |
| InChIKey | NFPUKORFULYMDQ-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |