C16H14N2S — CID 135222578
4-(5-benzyl-1,3-thiazol-2-yl)aniline (PubChem CID 135222578) has the molecular formula C16H14N2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 4-(5-benzyl-1,3-thiazol-2-yl)aniline.
| Compound Name | 4-(5-benzyl-1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 135222578 |
| Molecular Formula | C16H14N2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-(5-benzyl-1,3-thiazol-2-yl)aniline |
| SMILES | Nc1ccc(-c2ncc(Cc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C16H14N2S/c17-14-8-6-13(7-9-14)16-18-11-15(19-16)10-12-4-2-1-3-5-12/h1-9,11H,10,17H2 |
| InChIKey | RMDFPLGJEJDPFJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|