C21H19N5OS — CID 135223230
1-[4-(5-benzyl-1,3-thiazol-2-yl)phenyl]-3-(1H-pyrazol-4-ylmethyl)urea (PubChem CID 135223230) has the molecular formula C21H19N5OS and a molecular weight of 389.48 g/mol. Its IUPAC name is 1-[4-(5-benzyl-1,3-thiazol-2-yl)phenyl]-3-(1H-pyrazol-4-ylmethyl)urea.
| Compound Name | 1-[4-(5-benzyl-1,3-thiazol-2-yl)phenyl]-3-(1H-pyrazol-4-ylmethyl)urea |
|---|---|
| PubChem CID | 135223230 |
| Molecular Formula | C21H19N5OS |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 1-[4-(5-benzyl-1,3-thiazol-2-yl)phenyl]-3-(1H-pyrazol-4-ylmethyl)urea |
| SMILES | O=C(NCc1cn[nH]c1)Nc1ccc(-c2ncc(Cc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C21H19N5OS/c27-21(23-11-16-12-24-25-13-16)26-18-8-6-17(7-9-18)20-22-14-19(28-20)10-15-4-2-1-3-5-15/h1-9,12-14H,10-11H2,(H,24,25)(H2,23,26,27) |
| InChIKey | LTPQBNLNQCAVTR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |