C18H18N5O3S- — CID 174214469
4-[[[4-[phenyl-(sulfinatoamino)methyl]phenyl]carbamoylamino]methyl]-1H-pyrazole (PubChem CID 174214469) has the molecular formula C18H18N5O3S- and a molecular weight of 384.44 g/mol. Its IUPAC name is 4-[[[4-[phenyl-(sulfinatoamino)methyl]phenyl]carbamoylamino]methyl]-1H-pyrazole.
| Compound Name | 4-[[[4-[phenyl-(sulfinatoamino)methyl]phenyl]carbamoylamino]methyl]-1H-pyrazole |
|---|---|
| PubChem CID | 174214469 |
| Molecular Formula | C18H18N5O3S- |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 4-[[[4-[phenyl-(sulfinatoamino)methyl]phenyl]carbamoylamino]methyl]-1H-pyrazole |
| SMILES | O=C(NCc1cn[nH]c1)Nc1ccc(C(NS(=O)[O-])c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19N5O3S/c24-18(19-10-13-11-20-21-12-13)22-16-8-6-15(7-9-16)17(23-27(25)26)14-4-2-1-3-5-14/h1-9,11-12,17,23H,10H2,(H,20,21)(H,25,26)(H2,19,22,24)/p-1 |
| InChIKey | TUFAZHPMBWVTIC-UHFFFAOYSA-M |
| XLogP | 2.20 |
| TPSA | 121.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|