C18H16N6OS — CID 135222667
1-[4-(1,3-benzothiazol-2-ylamino)phenyl]-3-(1H-pyrazol-4-ylmethyl)urea (PubChem CID 135222667) has the molecular formula C18H16N6OS and a molecular weight of 364.43 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-ylamino)phenyl]-3-(1H-pyrazol-4-ylmethyl)urea.
| Compound Name | 1-[4-(1,3-benzothiazol-2-ylamino)phenyl]-3-(1H-pyrazol-4-ylmethyl)urea |
|---|---|
| PubChem CID | 135222667 |
| Molecular Formula | C18H16N6OS |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-ylamino)phenyl]-3-(1H-pyrazol-4-ylmethyl)urea |
| SMILES | O=C(NCc1cn[nH]c1)Nc1ccc(Nc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C18H16N6OS/c25-17(19-9-12-10-20-21-11-12)22-13-5-7-14(8-6-13)23-18-24-15-3-1-2-4-16(15)26-18/h1-8,10-11H,9H2,(H,20,21)(H,23,24)(H2,19,22,25) |
| InChIKey | CMNUNODXFDIGQN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |