C26H18Cl2N4O2S — CID 155806670
1-[4-[4-(1,3-benzothiazol-2-ylamino)phenoxy]phenyl]-3-(3,4-dichlorophenyl)urea (PubChem CID 155806670) has the molecular formula C26H18Cl2N4O2S and a molecular weight of 521.43 g/mol. Its IUPAC name is 1-[4-[4-(1,3-benzothiazol-2-ylamino)phenoxy]phenyl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[4-[4-(1,3-benzothiazol-2-ylamino)phenoxy]phenyl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 155806670 |
| Molecular Formula | C26H18Cl2N4O2S |
| Molecular Weight | 521.43 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | 1-[4-[4-(1,3-benzothiazol-2-ylamino)phenoxy]phenyl]-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Oc2ccc(Nc3nc4ccccc4s3)cc2)cc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H18Cl2N4O2S/c27-21-14-9-18(15-22(21)28)30-25(33)29-16-5-10-19(11-6-16)34-20-12-7-17(8-13-20)31-26-32-23-3-1-2-4-24(23)35-26/h1-15H,(H,31,32)(H2,29,30,33) |
| InChIKey | MZIDKVMXXPRAOT-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.43 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |