C20H14F2N4OS — CID 24760834
1-(2-anilino-1,3-benzothiazol-6-yl)-3-(2,6-difluorophenyl)urea (PubChem CID 24760834) has the molecular formula C20H14F2N4OS and a molecular weight of 396.42 g/mol. Its IUPAC name is 1-(2-anilino-1,3-benzothiazol-6-yl)-3-(2,6-difluorophenyl)urea.
| Compound Name | 1-(2-anilino-1,3-benzothiazol-6-yl)-3-(2,6-difluorophenyl)urea |
|---|---|
| PubChem CID | 24760834 |
| Molecular Formula | C20H14F2N4OS |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 1-(2-anilino-1,3-benzothiazol-6-yl)-3-(2,6-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc2nc(Nc3ccccc3)sc2c1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C20H14F2N4OS/c21-14-7-4-8-15(22)18(14)26-19(27)23-13-9-10-16-17(11-13)28-20(25-16)24-12-5-2-1-3-6-12/h1-11H,(H,24,25)(H2,23,26,27) |
| InChIKey | CTHSZKDEBWKXBG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |