C20H13FN2O2S — CID 7147094
4-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]benzoic acid (PubChem CID 7147094) has the molecular formula C20H13FN2O2S and a molecular weight of 364.40 g/mol. Its IUPAC name is 4-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]benzoic acid.
| Compound Name | 4-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 7147094 |
| Molecular Formula | C20H13FN2O2S |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 4-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(Nc3nc4ccc(F)cc4s3)cc2)cc1 |
| InChI | InChI=1S/C20H13FN2O2S/c21-15-7-10-17-18(11-15)26-20(23-17)22-16-8-5-13(6-9-16)12-1-3-14(4-2-12)19(24)25/h1-11H,(H,22,23)(H,24,25) |
| InChIKey | AMMQBBXJNLMQOB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |