C20H12ClFN2O2S — CID 59385271
2-chloro-4-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]benzoic acid (PubChem CID 59385271) has the molecular formula C20H12ClFN2O2S and a molecular weight of 398.85 g/mol. Its IUPAC name is 2-chloro-4-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]benzoic acid.
| Compound Name | 2-chloro-4-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 59385271 |
| Molecular Formula | C20H12ClFN2O2S |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 2-chloro-4-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(Nc3nc4ccc(F)cc4s3)cc2)cc1Cl |
| InChI | InChI=1S/C20H12ClFN2O2S/c21-16-9-12(3-7-15(16)19(25)26)11-1-5-14(6-2-11)23-20-24-17-8-4-13(22)10-18(17)27-20/h1-10H,(H,23,24)(H,25,26) |
| InChIKey | BKONZJDHGUKBIY-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |