C24H22N4O5S — CID 46325858
N-[6-[(3,4,5-trimethoxyphenyl)carbamoylamino]-1,3-benzothiazol-2-yl]benzamide (PubChem CID 46325858) has the molecular formula C24H22N4O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is N-[6-[(3,4,5-trimethoxyphenyl)carbamoylamino]-1,3-benzothiazol-2-yl]benzamide.
| Compound Name | N-[6-[(3,4,5-trimethoxyphenyl)carbamoylamino]-1,3-benzothiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 46325858 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | N-[6-[(3,4,5-trimethoxyphenyl)carbamoylamino]-1,3-benzothiazol-2-yl]benzamide |
| SMILES | COc1cc(NC(=O)Nc2ccc3nc(NC(=O)c4ccccc4)sc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H22N4O5S/c1-31-18-11-16(12-19(32-2)21(18)33-3)26-23(30)25-15-9-10-17-20(13-15)34-24(27-17)28-22(29)14-7-5-4-6-8-14/h4-13H,1-3H3,(H2,25,26,30)(H,27,28,29) |
| InChIKey | ZEHPZHKNCOJNLW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |