C14H11N3OS — CID 103602868
3-(1,3-benzothiazol-2-ylamino)benzamide (PubChem CID 103602868) has the molecular formula C14H11N3OS and a molecular weight of 269.33 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylamino)benzamide.
| Compound Name | 3-(1,3-benzothiazol-2-ylamino)benzamide |
|---|---|
| PubChem CID | 103602868 |
| Molecular Formula | C14H11N3OS |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylamino)benzamide |
| SMILES | NC(=O)c1cccc(Nc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C14H11N3OS/c15-13(18)9-4-3-5-10(8-9)16-14-17-11-6-1-2-7-12(11)19-14/h1-8H,(H2,15,18)(H,16,17) |
| InChIKey | NOOGUQYNMJKJHQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |