C17H15N5OS — CID 174676859
N-phenyl-1,3-benzothiazol-2-amine;1H-pyrazole-5-carboxamide (PubChem CID 174676859) has the molecular formula C17H15N5OS and a molecular weight of 337.41 g/mol. Its IUPAC name is N-phenyl-1,3-benzothiazol-2-amine;1H-pyrazole-5-carboxamide.
| Compound Name | N-phenyl-1,3-benzothiazol-2-amine;1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 174676859 |
| Molecular Formula | C17H15N5OS |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-phenyl-1,3-benzothiazol-2-amine;1H-pyrazole-5-carboxamide |
| SMILES | NC(=O)c1ccn[nH]1.c1ccc(Nc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C13H10N2S.C4H5N3O/c1-2-6-10(7-3-1)14-13-15-11-8-4-5-9-12(11)16-13;5-4(8)3-1-2-6-7-3/h1-9H,(H,14,15);1-2H,(H2,5,8)(H,6,7) |
| InChIKey | FIMHOGNOYMIJBF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |