C11H8N4S — CID 25239704
N-pyrimidin-2-yl-1,3-benzothiazol-2-amine (PubChem CID 25239704) has the molecular formula C11H8N4S and a molecular weight of 228.28 g/mol. Its IUPAC name is N-pyrimidin-2-yl-1,3-benzothiazol-2-amine.
| Compound Name | N-pyrimidin-2-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 25239704 |
| Molecular Formula | C11H8N4S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | N-pyrimidin-2-yl-1,3-benzothiazol-2-amine |
| SMILES | c1cnc(Nc2nc3ccccc3s2)nc1 |
| InChI | InChI=1S/C11H8N4S/c1-2-5-9-8(4-1)14-11(16-9)15-10-12-6-3-7-13-10/h1-7H,(H,12,13,14,15) |
| InChIKey | CJTOFJMUMLSNLZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |