C16H11N3S — CID 29067966
N-quinolin-8-yl-1,3-benzothiazol-2-amine (PubChem CID 29067966) has the molecular formula C16H11N3S and a molecular weight of 277.35 g/mol. Its IUPAC name is N-quinolin-8-yl-1,3-benzothiazol-2-amine.
| Compound Name | N-quinolin-8-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 29067966 |
| Molecular Formula | C16H11N3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-quinolin-8-yl-1,3-benzothiazol-2-amine |
| SMILES | c1cnc2c(Nc3nc4ccccc4s3)cccc2c1 |
| InChI | InChI=1S/C16H11N3S/c1-2-9-14-12(7-1)18-16(20-14)19-13-8-3-5-11-6-4-10-17-15(11)13/h1-10H,(H,18,19) |
| InChIKey | ACPUCDINIUSLJS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |