C19H14N6S — CID 66768396
4-(1,3-benzothiazol-2-yl)-3-N-quinolin-8-yl-1H-pyrazole-3,5-diamine (PubChem CID 66768396) has the molecular formula C19H14N6S and a molecular weight of 358.43 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-3-N-quinolin-8-yl-1H-pyrazole-3,5-diamine.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-3-N-quinolin-8-yl-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 66768396 |
| Molecular Formula | C19H14N6S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-3-N-quinolin-8-yl-1H-pyrazole-3,5-diamine |
| SMILES | Nc1[nH]nc(Nc2cccc3cccnc23)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H14N6S/c20-17-15(19-23-12-7-1-2-9-14(12)26-19)18(25-24-17)22-13-8-3-5-11-6-4-10-21-16(11)13/h1-10H,(H4,20,22,24,25) |
| InChIKey | DJTUZMXCNMIEDW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |