C16H14N6S — CID 66768481
3-N-(4-aminophenyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine (PubChem CID 66768481) has the molecular formula C16H14N6S and a molecular weight of 322.40 g/mol. Its IUPAC name is 3-N-(4-aminophenyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine.
| Compound Name | 3-N-(4-aminophenyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 66768481 |
| Molecular Formula | C16H14N6S |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3-N-(4-aminophenyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine |
| SMILES | Nc1ccc(Nc2n[nH]c(N)c2-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C16H14N6S/c17-9-5-7-10(8-6-9)19-15-13(14(18)21-22-15)16-20-11-3-1-2-4-12(11)23-16/h1-8H,17H2,(H4,18,19,21,22) |
| InChIKey | PLSYJNIKYWCABG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|