C17H14N6S — CID 11404857
5-(1,3-benzothiazol-2-yl)-4-N-phenylpyrimidine-2,4,6-triamine (PubChem CID 11404857) has the molecular formula C17H14N6S and a molecular weight of 334.41 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-4-N-phenylpyrimidine-2,4,6-triamine.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-4-N-phenylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 11404857 |
| Molecular Formula | C17H14N6S |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-4-N-phenylpyrimidine-2,4,6-triamine |
| SMILES | Nc1nc(N)c(-c2nc3ccccc3s2)c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H14N6S/c18-14-13(16-21-11-8-4-5-9-12(11)24-16)15(23-17(19)22-14)20-10-6-2-1-3-7-10/h1-9H,(H5,18,19,20,22,23) |
| InChIKey | SKSIRPDHCBSPCE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |