C13H12N4 — CID 142650231
4-N-(1H-indazol-3-yl)benzene-1,4-diamine (PubChem CID 142650231) has the molecular formula C13H12N4 and a molecular weight of 224.27 g/mol. Its IUPAC name is 4-N-(1H-indazol-3-yl)benzene-1,4-diamine.
| Compound Name | 4-N-(1H-indazol-3-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 142650231 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 4-N-(1H-indazol-3-yl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2n[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C13H12N4/c14-9-5-7-10(8-6-9)15-13-11-3-1-2-4-12(11)16-17-13/h1-8H,14H2,(H2,15,16,17) |
| InChIKey | AGFKKQZBWAFLPZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|