C13H11FN4 — CID 69074655
3-N-(4-fluorophenyl)-1H-indazole-3,5-diamine (PubChem CID 69074655) has the molecular formula C13H11FN4 and a molecular weight of 242.26 g/mol. Its IUPAC name is 3-N-(4-fluorophenyl)-1H-indazole-3,5-diamine.
| Compound Name | 3-N-(4-fluorophenyl)-1H-indazole-3,5-diamine |
|---|---|
| PubChem CID | 69074655 |
| Molecular Formula | C13H11FN4 |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 3-N-(4-fluorophenyl)-1H-indazole-3,5-diamine |
| SMILES | Nc1ccc2[nH]nc(Nc3ccc(F)cc3)c2c1 |
| InChI | InChI=1S/C13H11FN4/c14-8-1-4-10(5-2-8)16-13-11-7-9(15)3-6-12(11)17-18-13/h1-7H,15H2,(H2,16,17,18) |
| InChIKey | ZCPDRKBOWHROHV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|