C15H14FN3O2 — CID 162651967
N-(3,4-dimethoxyphenyl)-6-fluoro-1H-indazol-3-amine (PubChem CID 162651967) has the molecular formula C15H14FN3O2 and a molecular weight of 287.29 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-6-fluoro-1H-indazol-3-amine.
| Compound Name | N-(3,4-dimethoxyphenyl)-6-fluoro-1H-indazol-3-amine |
|---|---|
| PubChem CID | 162651967 |
| Molecular Formula | C15H14FN3O2 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-6-fluoro-1H-indazol-3-amine |
| SMILES | COc1ccc(Nc2n[nH]c3cc(F)ccc23)cc1OC |
| InChI | InChI=1S/C15H14FN3O2/c1-20-13-6-4-10(8-14(13)21-2)17-15-11-5-3-9(16)7-12(11)18-19-15/h3-8H,1-2H3,(H2,17,18,19) |
| InChIKey | GXFPQONUJTVXNJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |