C18H19N3O4S — CID 15994903
4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione (PubChem CID 15994903) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione.
| Compound Name | 4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione |
|---|---|
| PubChem CID | 15994903 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione |
| SMILES | COc1ccc(Nc2nc(=S)[nH]c3cc(OC)c(OC)cc23)cc1OC |
| InChI | InChI=1S/C18H19N3O4S/c1-22-13-6-5-10(7-14(13)23-2)19-17-11-8-15(24-3)16(25-4)9-12(11)20-18(26)21-17/h5-9H,1-4H3,(H2,19,20,21,26) |
| InChIKey | RWMUAMGKWKNBKR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|