About 4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione
4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione (PubChem CID 15994903) has the molecular formula C18H19N3O4S
and a molecular weight of 373.43 g/mol. Its IUPAC name is 4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione.
Molecular Properties
| Compound Name | 4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione |
| PubChem CID | 15994903 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione |
| SMILES | COc1ccc(Nc2nc(=S)[nH]c3cc(OC)c(OC)cc23)cc1OC |
| InChI | InChI=1S/C18H19N3O4S/c1-22-13-6-5-10(7-14(13)23-2)19-17-11-8-15(24-3)16(25-4)9-12(11)20-18(26)21-17/h5-9H,1-4H3,(H2,19,20,21,26) |
| InChIKey | RWMUAMGKWKNBKR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione?
The IUPAC name of 4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione (CID 15994903) is 4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione.
What is the SMILES notation for 4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione?
The canonical SMILES for 4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione is COc1ccc(Nc2nc(=S)[nH]c3cc(OC)c(OC)cc23)cc1OC.
What is the InChIKey of 4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione?
The InChIKey is RWMUAMGKWKNBKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O4S/c1-22-13-6-5-10(7-14(13)23-2)19-17-11-8-15(24-3)16(25-4)9-12(11)20-18(26)21-17/h5-9H,1-4H3,(H2,19,20,21,26).
What are the key properties of 4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione?
4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione has a molecular weight of 373.43 g/mol, XLogP of 4.07, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethoxyanilino)-6,7-dimethoxy-1H-quinazoline-2-thione is sourced from PubChem (CID 15994903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).