C16H19N5O2 — CID 10591280
N-(3,4-dimethoxyphenyl)-2-propyl-7H-purin-6-amine (PubChem CID 10591280) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-propyl-7H-purin-6-amine.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-propyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 10591280 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-propyl-7H-purin-6-amine |
| SMILES | CCCc1nc(Nc2ccc(OC)c(OC)c2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C16H19N5O2/c1-4-5-13-20-15-14(17-9-18-15)16(21-13)19-10-6-7-11(22-2)12(8-10)23-3/h6-9H,4-5H2,1-3H3,(H2,17,18,19,20,21) |
| InChIKey | KUZDDZJUIVNHDR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |