C13H12ClN5O2 — CID 104787098
2-chloro-N-(2,4-dimethoxyphenyl)-7H-purin-6-amine (PubChem CID 104787098) has the molecular formula C13H12ClN5O2 and a molecular weight of 305.73 g/mol. Its IUPAC name is 2-chloro-N-(2,4-dimethoxyphenyl)-7H-purin-6-amine.
| Compound Name | 2-chloro-N-(2,4-dimethoxyphenyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 104787098 |
| Molecular Formula | C13H12ClN5O2 |
| Molecular Weight | 305.73 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-chloro-N-(2,4-dimethoxyphenyl)-7H-purin-6-amine |
| SMILES | COc1ccc(Nc2nc(Cl)nc3nc[nH]c23)c(OC)c1 |
| InChI | InChI=1S/C13H12ClN5O2/c1-20-7-3-4-8(9(5-7)21-2)17-12-10-11(16-6-15-10)18-13(14)19-12/h3-6H,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | HZVRTVLHMKNQIY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.73 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |