C10H7ClN6 — CID 155102926
2-chloro-N-pyridin-4-yl-7H-purin-6-amine (PubChem CID 155102926) has the molecular formula C10H7ClN6 and a molecular weight of 246.66 g/mol. Its IUPAC name is 2-chloro-N-pyridin-4-yl-7H-purin-6-amine.
| Compound Name | 2-chloro-N-pyridin-4-yl-7H-purin-6-amine |
|---|---|
| PubChem CID | 155102926 |
| Molecular Formula | C10H7ClN6 |
| Molecular Weight | 246.66 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 2-chloro-N-pyridin-4-yl-7H-purin-6-amine |
| SMILES | Clc1nc(Nc2ccncc2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C10H7ClN6/c11-10-16-8-7(13-5-14-8)9(17-10)15-6-1-3-12-4-2-6/h1-5H,(H2,12,13,14,15,16,17) |
| InChIKey | TVKUJERZHQHRNE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.66 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |