C13H13ClN6 — CID 104787440
1-N-(2-chloro-7H-purin-6-yl)-3-N,3-N-dimethylbenzene-1,3-diamine (PubChem CID 104787440) has the molecular formula C13H13ClN6 and a molecular weight of 288.74 g/mol. Its IUPAC name is 1-N-(2-chloro-7H-purin-6-yl)-3-N,3-N-dimethylbenzene-1,3-diamine.
| Compound Name | 1-N-(2-chloro-7H-purin-6-yl)-3-N,3-N-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 104787440 |
| Molecular Formula | C13H13ClN6 |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-N-(2-chloro-7H-purin-6-yl)-3-N,3-N-dimethylbenzene-1,3-diamine |
| SMILES | CN(C)c1cccc(Nc2nc(Cl)nc3nc[nH]c23)c1 |
| InChI | InChI=1S/C13H13ClN6/c1-20(2)9-5-3-4-8(6-9)17-12-10-11(16-7-15-10)18-13(14)19-12/h3-7H,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | FASSXBCTVULTFA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |