C10H15ClN6 — CID 104697478
N-(2-chloro-7H-purin-6-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 104697478) has the molecular formula C10H15ClN6 and a molecular weight of 254.72 g/mol. Its IUPAC name is N-(2-chloro-7H-purin-6-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(2-chloro-7H-purin-6-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 104697478 |
| Molecular Formula | C10H15ClN6 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | N-(2-chloro-7H-purin-6-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H15ClN6/c1-17(2)5-3-4-12-8-7-9(14-6-13-7)16-10(11)15-8/h6H,3-5H2,1-2H3,(H2,12,13,14,15,16) |
| InChIKey | BTUHFNUDAWUNRS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|