C9H11ClN6O — CID 104697631
3-[(2-chloro-7H-purin-6-yl)amino]-N-methylpropanamide (PubChem CID 104697631) has the molecular formula C9H11ClN6O and a molecular weight of 254.68 g/mol. Its IUPAC name is 3-[(2-chloro-7H-purin-6-yl)amino]-N-methylpropanamide.
| Compound Name | 3-[(2-chloro-7H-purin-6-yl)amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 104697631 |
| Molecular Formula | C9H11ClN6O |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 3-[(2-chloro-7H-purin-6-yl)amino]-N-methylpropanamide |
| SMILES | CNC(=O)CCNc1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C9H11ClN6O/c1-11-5(17)2-3-12-7-6-8(14-4-13-6)16-9(10)15-7/h4H,2-3H2,1H3,(H,11,17)(H2,12,13,14,15,16) |
| InChIKey | PZLRWEPKGRJAHU-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |