C10H13ClN6O — CID 106279554
3-[(2-chloro-7H-purin-6-yl)amino]-2,2-dimethylpropanamide (PubChem CID 106279554) has the molecular formula C10H13ClN6O and a molecular weight of 268.71 g/mol. Its IUPAC name is 3-[(2-chloro-7H-purin-6-yl)amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[(2-chloro-7H-purin-6-yl)amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106279554 |
| Molecular Formula | C10H13ClN6O |
| Molecular Weight | 268.71 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 3-[(2-chloro-7H-purin-6-yl)amino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNc1nc(Cl)nc2nc[nH]c12)C(N)=O |
| InChI | InChI=1S/C10H13ClN6O/c1-10(2,8(12)18)3-13-6-5-7(15-4-14-5)17-9(11)16-6/h4H,3H2,1-2H3,(H2,12,18)(H2,13,14,15,16,17) |
| InChIKey | AMJHBGMJJLWLPG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.71 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |