C11H16ClN5O — CID 114152174
5-[(2-chloro-7H-purin-6-yl)amino]-2-methylpentan-1-ol (PubChem CID 114152174) has the molecular formula C11H16ClN5O and a molecular weight of 269.74 g/mol. Its IUPAC name is 5-[(2-chloro-7H-purin-6-yl)amino]-2-methylpentan-1-ol.
| Compound Name | 5-[(2-chloro-7H-purin-6-yl)amino]-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 114152174 |
| Molecular Formula | C11H16ClN5O |
| Molecular Weight | 269.74 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 5-[(2-chloro-7H-purin-6-yl)amino]-2-methylpentan-1-ol |
| SMILES | CC(CO)CCCNc1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C11H16ClN5O/c1-7(5-18)3-2-4-13-9-8-10(15-6-14-8)17-11(12)16-9/h6-7,18H,2-5H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | WTMYBYWOTIYRKE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.74 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|