C10H10ClN5S — CID 106432038
2-chloro-N-(2-prop-2-ynylsulfanylethyl)-7H-purin-6-amine (PubChem CID 106432038) has the molecular formula C10H10ClN5S and a molecular weight of 267.74 g/mol. Its IUPAC name is 2-chloro-N-(2-prop-2-ynylsulfanylethyl)-7H-purin-6-amine.
| Compound Name | 2-chloro-N-(2-prop-2-ynylsulfanylethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 106432038 |
| Molecular Formula | C10H10ClN5S |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 2-chloro-N-(2-prop-2-ynylsulfanylethyl)-7H-purin-6-amine |
| SMILES | C#CCSCCNc1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H10ClN5S/c1-2-4-17-5-3-12-8-7-9(14-6-13-7)16-10(11)15-8/h1,6H,3-5H2,(H2,12,13,14,15,16) |
| InChIKey | OEEAYPNTMLTTFZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|