C8H8Cl2N4S — CID 106432020
3,6-dichloro-N-(2-prop-2-ynylsulfanylethyl)-1,2,4-triazin-5-amine (PubChem CID 106432020) has the molecular formula C8H8Cl2N4S and a molecular weight of 263.15 g/mol. Its IUPAC name is 3,6-dichloro-N-(2-prop-2-ynylsulfanylethyl)-1,2,4-triazin-5-amine.
| Compound Name | 3,6-dichloro-N-(2-prop-2-ynylsulfanylethyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 106432020 |
| Molecular Formula | C8H8Cl2N4S |
| Molecular Weight | 263.15 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 3,6-dichloro-N-(2-prop-2-ynylsulfanylethyl)-1,2,4-triazin-5-amine |
| SMILES | C#CCSCCNc1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C8H8Cl2N4S/c1-2-4-15-5-3-11-7-6(9)13-14-8(10)12-7/h1H,3-5H2,(H,11,12,14) |
| InChIKey | MDAFVUZJBHFTED-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.15 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|