C9H10ClN3S — CID 102975894
5-chloro-N-(2-prop-2-ynylsulfanylethyl)pyrimidin-4-amine (PubChem CID 102975894) has the molecular formula C9H10ClN3S and a molecular weight of 227.72 g/mol. Its IUPAC name is 5-chloro-N-(2-prop-2-ynylsulfanylethyl)pyrimidin-4-amine.
| Compound Name | 5-chloro-N-(2-prop-2-ynylsulfanylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 102975894 |
| Molecular Formula | C9H10ClN3S |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 5-chloro-N-(2-prop-2-ynylsulfanylethyl)pyrimidin-4-amine |
| SMILES | C#CCSCCNc1ncncc1Cl |
| InChI | InChI=1S/C9H10ClN3S/c1-2-4-14-5-3-12-9-8(10)6-11-7-13-9/h1,6-7H,3-5H2,(H,11,12,13) |
| InChIKey | ONFKRIUJMWLFET-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|