C8H13Cl2N5 — CID 81036688
N-(3,6-dichloro-1,2,4-triazin-5-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 81036688) has the molecular formula C8H13Cl2N5 and a molecular weight of 250.13 g/mol. Its IUPAC name is N-(3,6-dichloro-1,2,4-triazin-5-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(3,6-dichloro-1,2,4-triazin-5-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 81036688 |
| Molecular Formula | C8H13Cl2N5 |
| Molecular Weight | 250.13 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | N-(3,6-dichloro-1,2,4-triazin-5-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C8H13Cl2N5/c1-15(2)5-3-4-11-7-6(9)13-14-8(10)12-7/h3-5H2,1-2H3,(H,11,12,14) |
| InChIKey | LSURTHBWZCKFGB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.13 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|