C6H6Cl2F2N4 — CID 130631788
3,6-dichloro-N-(3,3-difluoropropyl)-1,2,4-triazin-5-amine (PubChem CID 130631788) has the molecular formula C6H6Cl2F2N4 and a molecular weight of 243.04 g/mol. Its IUPAC name is 3,6-dichloro-N-(3,3-difluoropropyl)-1,2,4-triazin-5-amine.
| Compound Name | 3,6-dichloro-N-(3,3-difluoropropyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 130631788 |
| Molecular Formula | C6H6Cl2F2N4 |
| Molecular Weight | 243.04 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 3,6-dichloro-N-(3,3-difluoropropyl)-1,2,4-triazin-5-amine |
| SMILES | FC(F)CCNc1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C6H6Cl2F2N4/c7-4-5(11-2-1-3(9)10)12-6(8)14-13-4/h3H,1-2H2,(H,11,12,14) |
| InChIKey | CFDQPRMBOWUDGW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.04 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |