C9H14Cl2N4O — CID 82943113
3,6-dichloro-N-(3-propoxypropyl)-1,2,4-triazin-5-amine (PubChem CID 82943113) has the molecular formula C9H14Cl2N4O and a molecular weight of 265.14 g/mol. Its IUPAC name is 3,6-dichloro-N-(3-propoxypropyl)-1,2,4-triazin-5-amine.
| Compound Name | 3,6-dichloro-N-(3-propoxypropyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 82943113 |
| Molecular Formula | C9H14Cl2N4O |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 3,6-dichloro-N-(3-propoxypropyl)-1,2,4-triazin-5-amine |
| SMILES | CCCOCCCNc1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C9H14Cl2N4O/c1-2-5-16-6-3-4-12-8-7(10)14-15-9(11)13-8/h2-6H2,1H3,(H,12,13,15) |
| InChIKey | VKDVQZHMAACEKM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|