C7H10N4S2 — CID 106433856
5-N-(2-prop-2-ynylsulfanylethyl)-1,2,4-thiadiazole-3,5-diamine (PubChem CID 106433856) has the molecular formula C7H10N4S2 and a molecular weight of 214.32 g/mol. Its IUPAC name is 5-N-(2-prop-2-ynylsulfanylethyl)-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-(2-prop-2-ynylsulfanylethyl)-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 106433856 |
| Molecular Formula | C7H10N4S2 |
| Molecular Weight | 214.32 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 5-N-(2-prop-2-ynylsulfanylethyl)-1,2,4-thiadiazole-3,5-diamine |
| SMILES | C#CCSCCNc1nc(N)ns1 |
| InChI | InChI=1S/C7H10N4S2/c1-2-4-12-5-3-9-7-10-6(8)11-13-7/h1H,3-5H2,(H3,8,9,10,11) |
| InChIKey | AYUVVILJVPPMLJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|