C11H14N2S — CID 106426214
2-N-(2-prop-2-ynylsulfanylethyl)benzene-1,2-diamine (PubChem CID 106426214) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 2-N-(2-prop-2-ynylsulfanylethyl)benzene-1,2-diamine.
| Compound Name | 2-N-(2-prop-2-ynylsulfanylethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 106426214 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-N-(2-prop-2-ynylsulfanylethyl)benzene-1,2-diamine |
| SMILES | C#CCSCCNc1ccccc1N |
| InChI | InChI=1S/C11H14N2S/c1-2-8-14-9-7-13-11-6-4-3-5-10(11)12/h1,3-6,13H,7-9,12H2 |
| InChIKey | QXUZBDWSOKHLRQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|