C11H13N3O2S — CID 106426082
4-nitro-1-N-(2-prop-2-ynylsulfanylethyl)benzene-1,2-diamine (PubChem CID 106426082) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 4-nitro-1-N-(2-prop-2-ynylsulfanylethyl)benzene-1,2-diamine.
| Compound Name | 4-nitro-1-N-(2-prop-2-ynylsulfanylethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 106426082 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 4-nitro-1-N-(2-prop-2-ynylsulfanylethyl)benzene-1,2-diamine |
| SMILES | C#CCSCCNc1ccc([N+](=O)[O-])cc1N |
| InChI | InChI=1S/C11H13N3O2S/c1-2-6-17-7-5-13-11-4-3-9(14(15)16)8-10(11)12/h1,3-4,8,13H,5-7,12H2 |
| InChIKey | OERZDPJUGMOQLN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|