C12H12BrN3O2S — CID 106037277
1-N-[2-(5-bromothiophen-2-yl)ethyl]-4-nitrobenzene-1,2-diamine (PubChem CID 106037277) has the molecular formula C12H12BrN3O2S and a molecular weight of 342.22 g/mol. Its IUPAC name is 1-N-[2-(5-bromothiophen-2-yl)ethyl]-4-nitrobenzene-1,2-diamine.
| Compound Name | 1-N-[2-(5-bromothiophen-2-yl)ethyl]-4-nitrobenzene-1,2-diamine |
|---|---|
| PubChem CID | 106037277 |
| Molecular Formula | C12H12BrN3O2S |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 1-N-[2-(5-bromothiophen-2-yl)ethyl]-4-nitrobenzene-1,2-diamine |
| SMILES | Nc1cc([N+](=O)[O-])ccc1NCCc1ccc(Br)s1 |
| InChI | InChI=1S/C12H12BrN3O2S/c13-12-4-2-9(19-12)5-6-15-11-3-1-8(16(17)18)7-10(11)14/h1-4,7,15H,5-6,14H2 |
| InChIKey | IYADZWQGUSXLDZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|