C12H11Br2FN2S — CID 106037471
4-bromo-2-N-[2-(5-bromothiophen-2-yl)ethyl]-5-fluorobenzene-1,2-diamine (PubChem CID 106037471) has the molecular formula C12H11Br2FN2S and a molecular weight of 394.11 g/mol. Its IUPAC name is 4-bromo-2-N-[2-(5-bromothiophen-2-yl)ethyl]-5-fluorobenzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-[2-(5-bromothiophen-2-yl)ethyl]-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 106037471 |
| Molecular Formula | C12H11Br2FN2S |
| Molecular Weight | 394.11 g/mol |
| Exact Mass | 391.90 |
| IUPAC Name | 4-bromo-2-N-[2-(5-bromothiophen-2-yl)ethyl]-5-fluorobenzene-1,2-diamine |
| SMILES | Nc1cc(F)c(Br)cc1NCCc1ccc(Br)s1 |
| InChI | InChI=1S/C12H11Br2FN2S/c13-8-5-11(10(16)6-9(8)15)17-4-3-7-1-2-12(14)18-7/h1-2,5-6,17H,3-4,16H2 |
| InChIKey | PSMIABMUJPCBIH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.11 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|