C12H11BrClFN2S — CID 114139337
4-bromo-1-N-[2-(5-chlorothiophen-2-yl)ethyl]-5-fluorobenzene-1,2-diamine (PubChem CID 114139337) has the molecular formula C12H11BrClFN2S and a molecular weight of 349.66 g/mol. Its IUPAC name is 4-bromo-1-N-[2-(5-chlorothiophen-2-yl)ethyl]-5-fluorobenzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-[2-(5-chlorothiophen-2-yl)ethyl]-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 114139337 |
| Molecular Formula | C12H11BrClFN2S |
| Molecular Weight | 349.66 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | 4-bromo-1-N-[2-(5-chlorothiophen-2-yl)ethyl]-5-fluorobenzene-1,2-diamine |
| SMILES | Nc1cc(Br)c(F)cc1NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H11BrClFN2S/c13-8-5-10(16)11(6-9(8)15)17-4-3-7-1-2-12(14)18-7/h1-2,5-6,17H,3-4,16H2 |
| InChIKey | KSGCCMCOTKARGN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|