C12H12BrFN2S — CID 115125840
2-N-[2-(5-bromothiophen-2-yl)ethyl]-3-fluorobenzene-1,2-diamine (PubChem CID 115125840) has the molecular formula C12H12BrFN2S and a molecular weight of 315.21 g/mol. Its IUPAC name is 2-N-[2-(5-bromothiophen-2-yl)ethyl]-3-fluorobenzene-1,2-diamine.
| Compound Name | 2-N-[2-(5-bromothiophen-2-yl)ethyl]-3-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 115125840 |
| Molecular Formula | C12H12BrFN2S |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 2-N-[2-(5-bromothiophen-2-yl)ethyl]-3-fluorobenzene-1,2-diamine |
| SMILES | Nc1cccc(F)c1NCCc1ccc(Br)s1 |
| InChI | InChI=1S/C12H12BrFN2S/c13-11-5-4-8(17-11)6-7-16-12-9(14)2-1-3-10(12)15/h1-5,16H,6-7,15H2 |
| InChIKey | CWUKIVQKJZFREN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|