C13H14FN3 — CID 115125857
3-fluoro-2-N-(2-pyridin-4-ylethyl)benzene-1,2-diamine (PubChem CID 115125857) has the molecular formula C13H14FN3 and a molecular weight of 231.27 g/mol. Its IUPAC name is 3-fluoro-2-N-(2-pyridin-4-ylethyl)benzene-1,2-diamine.
| Compound Name | 3-fluoro-2-N-(2-pyridin-4-ylethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 115125857 |
| Molecular Formula | C13H14FN3 |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 3-fluoro-2-N-(2-pyridin-4-ylethyl)benzene-1,2-diamine |
| SMILES | Nc1cccc(F)c1NCCc1ccncc1 |
| InChI | InChI=1S/C13H14FN3/c14-11-2-1-3-12(15)13(11)17-9-6-10-4-7-16-8-5-10/h1-5,7-8,17H,6,9,15H2 |
| InChIKey | DNSLZMNMNXGFSN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|