C9H11F3N2 — CID 131093444
2-N-(3,3-difluoropropyl)-3-fluorobenzene-1,2-diamine (PubChem CID 131093444) has the molecular formula C9H11F3N2 and a molecular weight of 204.20 g/mol. Its IUPAC name is 2-N-(3,3-difluoropropyl)-3-fluorobenzene-1,2-diamine.
| Compound Name | 2-N-(3,3-difluoropropyl)-3-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 131093444 |
| Molecular Formula | C9H11F3N2 |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-N-(3,3-difluoropropyl)-3-fluorobenzene-1,2-diamine |
| SMILES | Nc1cccc(F)c1NCCC(F)F |
| InChI | InChI=1S/C9H11F3N2/c10-6-2-1-3-7(13)9(6)14-5-4-8(11)12/h1-3,8,14H,4-5,13H2 |
| InChIKey | XYBAHQJQAKVYGD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|