C15H14F4N2 — CID 22968008
N,N'-bis(2,6-difluorophenyl)propane-1,3-diamine (PubChem CID 22968008) has the molecular formula C15H14F4N2 and a molecular weight of 298.28 g/mol. Its IUPAC name is N,N'-bis(2,6-difluorophenyl)propane-1,3-diamine.
| Compound Name | N,N'-bis(2,6-difluorophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 22968008 |
| Molecular Formula | C15H14F4N2 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N,N'-bis(2,6-difluorophenyl)propane-1,3-diamine |
| SMILES | Fc1cccc(F)c1NCCCNc1c(F)cccc1F |
| InChI | InChI=1S/C15H14F4N2/c16-10-4-1-5-11(17)14(10)20-8-3-9-21-15-12(18)6-2-7-13(15)19/h1-2,4-7,20-21H,3,8-9H2 |
| InChIKey | VLTKHIJJTABJAA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|