C8H9F2N — CID 23270171
N-ethyl-2,6-difluoroaniline (PubChem CID 23270171) has the molecular formula C8H9F2N and a molecular weight of 157.16 g/mol. Its IUPAC name is N-ethyl-2,6-difluoroaniline.
| Compound Name | N-ethyl-2,6-difluoroaniline |
|---|---|
| PubChem CID | 23270171 |
| Molecular Formula | C8H9F2N |
| Molecular Weight | 157.16 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | N-ethyl-2,6-difluoroaniline |
| SMILES | CCNc1c(F)cccc1F |
| InChI | InChI=1S/C8H9F2N/c1-2-11-8-6(9)4-3-5-7(8)10/h3-5,11H,2H2,1H3 |
| InChIKey | AGBOLUHHTNPORL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.16 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |